About (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol
(2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol (PubChem CID 70961213) has the molecular formula C13H26O4S
and a molecular weight of 278.41 g/mol. Its IUPAC name is (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol.
Molecular Properties
| Compound Name | (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol |
| PubChem CID | 70961213 |
| Molecular Formula | C13H26O4S |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol |
| SMILES | CCCSCC1O[C@H](OCC)C(O)[C@@H](O)C1CC |
| InChI | InChI=1S/C13H26O4S/c1-4-7-18-8-10-9(5-2)11(14)12(15)13(17-10)16-6-3/h9-15H,4-8H2,1-3H3/t9?,10?,11-,12?,13-/m0/s1 |
| InChIKey | RRTZSKYTVGYMPO-PQZGQSDKSA-N |
| XLogP | 1.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol?
The IUPAC name of (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol (CID 70961213) is (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol.
What is the SMILES notation for (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol?
The canonical SMILES for (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol is CCCSCC1O[C@H](OCC)C(O)[C@@H](O)C1CC.
What is the InChIKey of (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol?
The InChIKey is RRTZSKYTVGYMPO-PQZGQSDKSA-N. The full InChI is InChI=1S/C13H26O4S/c1-4-7-18-8-10-9(5-2)11(14)12(15)13(17-10)16-6-3/h9-15H,4-8H2,1-3H3/t9?,10?,11-,12?,13-/m0/s1.
What are the key properties of (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol?
(2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol has a molecular weight of 278.41 g/mol, XLogP of 1.64, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2-ethoxy-5-ethyl-6-(propylsulfanylmethyl)oxane-3,4-diol is sourced from PubChem (CID 70961213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).