About 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine
2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine (PubChem CID 70961241) has the molecular formula C22H41N
and a molecular weight of 319.60 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine |
| PubChem CID | 70961241 |
| Molecular Formula | C22H41N |
| Molecular Weight | 319.60 g/mol |
| Exact Mass | 319.32 |
| IUPAC Name | 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine |
| SMILES | CCCCC(C)C(C=N[C@@H](C)CC(C)CCC=C(C)C)C1CC1 |
| InChI | InChI=1S/C22H41N/c1-7-8-12-19(5)22(21-13-14-21)16-23-20(6)15-18(4)11-9-10-17(2)3/h10,16,18-22H,7-9,11-15H2,1-6H3/t18?,19?,20-,22?/m0/s1 |
| InChIKey | PIZNPVGCGCSMMA-LJYGWVNYSA-N |
| XLogP | 7.90 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | 360 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine?
The IUPAC name of 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine (CID 70961241) is 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine.
What is the SMILES notation for 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine?
The canonical SMILES for 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine is CCCCC(C)C(C=N[C@@H](C)CC(C)CCC=C(C)C)C1CC1.
What is the InChIKey of 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine?
The InChIKey is PIZNPVGCGCSMMA-LJYGWVNYSA-N. The full InChI is InChI=1S/C22H41N/c1-7-8-12-19(5)22(21-13-14-21)16-23-20(6)15-18(4)11-9-10-17(2)3/h10,16,18-22H,7-9,11-15H2,1-6H3/t18?,19?,20-,22?/m0/s1.
What are the key properties of 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine?
2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine has a molecular weight of 319.60 g/mol, XLogP of 7.90, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[(2S)-4,8-dimethylnon-7-en-2-yl]-3-methylheptan-1-imine is sourced from PubChem (CID 70961241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).