C21H29N5 — CID 70961398
4-[(2R,4R)-4-amino-2-methylpyrrolidin-1-yl]-N,N-dimethyl-8-phenyl-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 70961398) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is 4-[(2R,4R)-4-amino-2-methylpyrrolidin-1-yl]-N,N-dimethyl-8-phenyl-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | 4-[(2R,4R)-4-amino-2-methylpyrrolidin-1-yl]-N,N-dimethyl-8-phenyl-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 70961398 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 4-[(2R,4R)-4-amino-2-methylpyrrolidin-1-yl]-N,N-dimethyl-8-phenyl-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | C[C@@H]1C[C@@H](N)CN1c1nc(N(C)C)nc2c1CCCC2c1ccccc1 |
| InChI | InChI=1S/C21H29N5/c1-14-12-16(22)13-26(14)20-18-11-7-10-17(15-8-5-4-6-9-15)19(18)23-21(24-20)25(2)3/h4-6,8-9,14,16-17H,7,10-13,22H2,1-3H3/t14-,16-,17?/m1/s1 |
| InChIKey | TZXPYWAIGKAHCQ-IYNBXCLQSA-N |
| XLogP | 2.94 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |