C16H25N3O — CID 70961687
5-[(2Z,6Z)-octa-2,6-dien-4-yl]-3-piperidin-4-yl-1H-imidazol-2-one (PubChem CID 70961687) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-[(2Z,6Z)-octa-2,6-dien-4-yl]-3-piperidin-4-yl-1H-imidazol-2-one.
| Compound Name | 5-[(2Z,6Z)-octa-2,6-dien-4-yl]-3-piperidin-4-yl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 70961687 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 5-[(2Z,6Z)-octa-2,6-dien-4-yl]-3-piperidin-4-yl-1H-imidazol-2-one |
| SMILES | C/C=C\CC(/C=C\C)c1cn(C2CCNCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H25N3O/c1-3-5-7-13(6-4-2)15-12-19(16(20)18-15)14-8-10-17-11-9-14/h3-6,12-14,17H,7-11H2,1-2H3,(H,18,20)/b5-3-,6-4- |
| InChIKey | NIJHVRZHQIJKSC-GLIMQPGKSA-N |
| XLogP | 2.73 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|