C35H47NO7 — CID 70962520
3-[(1'R,5'S,6'R)-11'-butoxy-6'-[cyclopropylmethyl(ethyl)amino]spiro[1,3-dioxolane-2,2'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene]-5'-yl]oxy-1-phenylpropane-1,2-diol (PubChem CID 70962520) has the molecular formula C35H47NO7 and a molecular weight of 593.76 g/mol. Its IUPAC name is 3-[(1'R,5'S,6'R)-11'-butoxy-6'-[cyclopropylmethyl(ethyl)amino]spiro[1,3-dioxolane-2,2'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene]-5'-yl]oxy-1-phenylpropane-1,2-diol.
| Compound Name | 3-[(1'R,5'S,6'R)-11'-butoxy-6'-[cyclopropylmethyl(ethyl)amino]spiro[1,3-dioxolane-2,2'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene]-5'-yl]oxy-1-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 70962520 |
| Molecular Formula | C35H47NO7 |
| Molecular Weight | 593.76 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | 3-[(1'R,5'S,6'R)-11'-butoxy-6'-[cyclopropylmethyl(ethyl)amino]spiro[1,3-dioxolane-2,2'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene]-5'-yl]oxy-1-phenylpropane-1,2-diol |
| SMILES | CCCCOc1ccc2c3c1O[C@@H]1C3[C@@](OCC(O)C(O)c3ccccc3)(CCC13OCCO3)[C@H](N(CC)CC1CC1)C2 |
| InChI | InChI=1S/C35H47NO7/c1-3-5-17-39-27-14-13-25-20-28(36(4-2)21-23-11-12-23)34(42-22-26(37)31(38)24-9-7-6-8-10-24)15-16-35(40-18-19-41-35)33-30(34)29(25)32(27)43-33/h6-10,13-14,23,26,28,30-31,33,37-38H,3-5,11-12,15-22H2,1-2H3/t26?,28-,30?,31?,33-,34-/m1/s1 |
| InChIKey | IDDLPIVJGUZMJH-AWBVPXMRSA-N |
| XLogP | 4.75 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.76 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|