C28H43NO7 — CID 70962557
3-[[(1R,5S,6R)-11-butoxy-6-[cyclopropylmethyl(ethyl)amino]-2-hydroxy-2-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-yl]oxy]propane-1,2-diol (PubChem CID 70962557) has the molecular formula C28H43NO7 and a molecular weight of 505.65 g/mol. Its IUPAC name is 3-[[(1R,5S,6R)-11-butoxy-6-[cyclopropylmethyl(ethyl)amino]-2-hydroxy-2-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-yl]oxy]propane-1,2-diol.
| Compound Name | 3-[[(1R,5S,6R)-11-butoxy-6-[cyclopropylmethyl(ethyl)amino]-2-hydroxy-2-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-yl]oxy]propane-1,2-diol |
|---|---|
| PubChem CID | 70962557 |
| Molecular Formula | C28H43NO7 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 3-[[(1R,5S,6R)-11-butoxy-6-[cyclopropylmethyl(ethyl)amino]-2-hydroxy-2-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-yl]oxy]propane-1,2-diol |
| SMILES | CCCCOc1ccc2c3c1O[C@@H]1C3[C@@](OCC(O)CO)(CCC1(O)OC)[C@H](N(CC)CC1CC1)C2 |
| InChI | InChI=1S/C28H43NO7/c1-4-6-13-34-21-10-9-19-14-22(29(5-2)15-18-7-8-18)27(35-17-20(31)16-30)11-12-28(32,33-3)26-24(27)23(19)25(21)36-26/h9-10,18,20,22,24,26,30-32H,4-8,11-17H2,1-3H3/t20?,22-,24?,26-,27-,28?/m1/s1 |
| InChIKey | PWBRSCNHGSAWSJ-SJSIMLSKSA-N |
| XLogP | 2.60 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|