C29H41N5O5 — CID 70962574
(1'R,5'S,6'R)-11'-butoxy-N-(cyclopropylmethyl)-N-ethyl-5'-[2-(2H-tetrazol-5-yl)ethoxy]spiro[1,3-dioxolane-2,2'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene]-6'-amine (PubChem CID 70962574) has the molecular formula C29H41N5O5 and a molecular weight of 539.68 g/mol. Its IUPAC name is (1'R,5'S,6'R)-11'-butoxy-N-(cyclopropylmethyl)-N-ethyl-5'-[2-(2H-tetrazol-5-yl)ethoxy]spiro[1,3-dioxolane-2,2'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene]-6'-amine.
| Compound Name | (1'R,5'S,6'R)-11'-butoxy-N-(cyclopropylmethyl)-N-ethyl-5'-[2-(2H-tetrazol-5-yl)ethoxy]spiro[1,3-dioxolane-2,2'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene]-6'-amine |
|---|---|
| PubChem CID | 70962574 |
| Molecular Formula | C29H41N5O5 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | (1'R,5'S,6'R)-11'-butoxy-N-(cyclopropylmethyl)-N-ethyl-5'-[2-(2H-tetrazol-5-yl)ethoxy]spiro[1,3-dioxolane-2,2'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene]-6'-amine |
| SMILES | CCCCOc1ccc2c3c1O[C@@H]1C3[C@@](OCCc3nn[nH]n3)(CCC13OCCO3)[C@H](N(CC)CC1CC1)C2 |
| InChI | InChI=1S/C29H41N5O5/c1-3-5-13-35-21-9-8-20-17-22(34(4-2)18-19-6-7-19)28(36-14-10-23-30-32-33-31-23)11-12-29(37-15-16-38-29)27-25(28)24(20)26(21)39-27/h8-9,19,22,25,27H,3-7,10-18H2,1-2H3,(H,30,31,32,33)/t22-,25?,27-,28-/m1/s1 |
| InChIKey | DUTZAMOJZXUIAP-LMRNCNAYSA-N |
| XLogP | 3.41 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|