About 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one
2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one (PubChem CID 70962726) has the molecular formula C19H16ClN3O
and a molecular weight of 337.81 g/mol. Its IUPAC name is 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one |
| PubChem CID | 70962726 |
| Molecular Formula | C19H16ClN3O |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2ncccc2nc(C2C[C@@H]3C[C@@H]3C2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3O/c20-14-3-5-15(6-4-14)23-18(13-9-11-8-12(11)10-13)22-16-2-1-7-21-17(16)19(23)24/h1-7,11-13H,8-10H2/t11-,12+,13? |
| InChIKey | SHXUYKQHMUFVIG-FUNVUKJBSA-N |
| XLogP | 3.95 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one (CID 70962726) is 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one is O=c1c2ncccc2nc(C2C[C@@H]3C[C@@H]3C2)n1-c1ccc(Cl)cc1.
What is the InChIKey of 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one?
The InChIKey is SHXUYKQHMUFVIG-FUNVUKJBSA-N. The full InChI is InChI=1S/C19H16ClN3O/c20-14-3-5-15(6-4-14)23-18(13-9-11-8-12(11)10-13)22-16-2-1-7-21-17(16)19(23)24/h1-7,11-13H,8-10H2/t11-,12+,13?.
What are the key properties of 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one?
2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one has a molecular weight of 337.81 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]-3-(4-chlorophenyl)pyrido[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 70962726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).