C13H16N2 — CID 70962974
3-ethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indole (PubChem CID 70962974) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-ethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indole.
| Compound Name | 3-ethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 70962974 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-ethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indole |
| SMILES | CCc1cnc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C13H16N2/c1-2-9-7-11-10-5-3-4-6-12(10)15-13(11)14-8-9/h7-8H,2-6H2,1H3,(H,14,15) |
| InChIKey | CGKFHKKAGIDLQI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |