About 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol
2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol (PubChem CID 70963269) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol.
Molecular Properties
| Compound Name | 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol |
| PubChem CID | 70963269 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol |
| SMILES | Cc1noc2cc(-c3cc(NCC(O)c4ccccc4)ncn3)ccc12 |
| InChI | InChI=1S/C20H18N4O2/c1-13-16-8-7-15(9-19(16)26-24-13)17-10-20(23-12-22-17)21-11-18(25)14-5-3-2-4-6-14/h2-10,12,18,25H,11H2,1H3,(H,21,22,23) |
| InChIKey | BQFXADFYLUAQEA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol?
The IUPAC name of 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol (CID 70963269) is 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol.
What is the SMILES notation for 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol?
The canonical SMILES for 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol is Cc1noc2cc(-c3cc(NCC(O)c4ccccc4)ncn3)ccc12.
What is the InChIKey of 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol?
The InChIKey is BQFXADFYLUAQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c1-13-16-8-7-15(9-19(16)26-24-13)17-10-20(23-12-22-17)21-11-18(25)14-5-3-2-4-6-14/h2-10,12,18,25H,11H2,1H3,(H,21,22,23).
What are the key properties of 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol?
2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol has a molecular weight of 346.39 g/mol, XLogP of 3.74, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-(3-methyl-1,2-benzoxazol-6-yl)pyrimidin-4-yl]amino]-1-phenylethanol is sourced from PubChem (CID 70963269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).