C19H19NO2 — CID 7096327
N-(3-acetylphenyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 7096327) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-(3-acetylphenyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 7096327 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-(3-acetylphenyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C19H19NO2/c1-13(21)15-7-4-8-18(12-15)20-19(22)17-10-9-14-5-2-3-6-16(14)11-17/h4,7-12H,2-3,5-6H2,1H3,(H,20,22) |
| InChIKey | ADFIMHHULHIDCE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |