C19H22N3O4S+ — CID 7096393
2-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide (PubChem CID 7096393) has the molecular formula C19H22N3O4S+ and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide.
| Compound Name | 2-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
|---|---|
| PubChem CID | 7096393 |
| Molecular Formula | C19H22N3O4S+ |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
| SMILES | CC[NH+]1CCc2c(sc(NC(=O)[C@H]3COc4ccccc4O3)c2C(N)=O)C1 |
| InChI | InChI=1S/C19H21N3O4S/c1-2-22-8-7-11-15(9-22)27-19(16(11)17(20)23)21-18(24)14-10-25-12-5-3-4-6-13(12)26-14/h3-6,14H,2,7-10H2,1H3,(H2,20,23)(H,21,24)/p+1/t14-/m1/s1 |
| InChIKey | YFJXSKUPFIWMFY-CQSZACIVSA-O |
| XLogP | 0.59 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |