C23H46O5Si2 — CID 70964337
trans-(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(oxan-2-yloxy)cyclohexan-1-one (PubChem CID 70964337) has the molecular formula C23H46O5Si2 and a molecular weight of 458.79 g/mol. Its IUPAC name is trans-(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(oxan-2-yloxy)cyclohexan-1-one.
| Compound Name | trans-(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(oxan-2-yloxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 70964337 |
| Molecular Formula | C23H46O5Si2 |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | trans-(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(oxan-2-yloxy)cyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(OC2CCCCO2)C[C@@H](O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C23H46O5Si2/c1-22(2,3)29(7,8)27-18-15-17(26-20-13-11-12-14-25-20)16-19(21(18)24)28-30(9,10)23(4,5)6/h17-20H,11-16H2,1-10H3/t18-,19-,20?/m1/s1 |
| InChIKey | AAGJXMOIMAGION-LEAGNCFPSA-N |
| XLogP | 6.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|