C14H17F3O5 — CID 70964912
(3R,4S,5S,6R)-2-(2,2-difluoro-2-phenylethyl)-2-fluoro-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 70964912) has the molecular formula C14H17F3O5 and a molecular weight of 322.28 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-(2,2-difluoro-2-phenylethyl)-2-fluoro-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-(2,2-difluoro-2-phenylethyl)-2-fluoro-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70964912 |
| Molecular Formula | C14H17F3O5 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (3R,4S,5S,6R)-2-(2,2-difluoro-2-phenylethyl)-2-fluoro-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(F)(CC(F)(F)c2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H17F3O5/c15-13(16,8-4-2-1-3-5-8)7-14(17)12(21)11(20)10(19)9(6-18)22-14/h1-5,9-12,18-21H,6-7H2/t9-,10-,11+,12-,14?/m1/s1 |
| InChIKey | IPBGXMOUEYCFCL-GRJWACCOSA-N |
| XLogP | 0.31 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |