C20H38O8Si — CID 70965410
ethyl (3R)-4-[(2R,4S,6R)-4-acetyloxy-6-[(2S)-2,4-dihydroxybutyl]oxan-2-yl]-3-trimethylsilyloxybutanoate (PubChem CID 70965410) has the molecular formula C20H38O8Si and a molecular weight of 434.60 g/mol. Its IUPAC name is ethyl (3R)-4-[(2R,4S,6R)-4-acetyloxy-6-[(2S)-2,4-dihydroxybutyl]oxan-2-yl]-3-trimethylsilyloxybutanoate.
| Compound Name | ethyl (3R)-4-[(2R,4S,6R)-4-acetyloxy-6-[(2S)-2,4-dihydroxybutyl]oxan-2-yl]-3-trimethylsilyloxybutanoate |
|---|---|
| PubChem CID | 70965410 |
| Molecular Formula | C20H38O8Si |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | ethyl (3R)-4-[(2R,4S,6R)-4-acetyloxy-6-[(2S)-2,4-dihydroxybutyl]oxan-2-yl]-3-trimethylsilyloxybutanoate |
| SMILES | CCOC(=O)C[C@@H](C[C@H]1C[C@@H](OC(C)=O)C[C@@H](C[C@@H](O)CCO)O1)O[Si](C)(C)C |
| InChI | InChI=1S/C20H38O8Si/c1-6-25-20(24)13-19(28-29(3,4)5)12-18-11-17(26-14(2)22)10-16(27-18)9-15(23)7-8-21/h15-19,21,23H,6-13H2,1-5H3/t15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | UNWGVSSLIVUMAF-ZWJWXYIHSA-N |
| XLogP | 2.16 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|