C14H22O6 — CID 70965616
ethyl (1R,6R,7S)-6-methoxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 70965616) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is ethyl (1R,6R,7S)-6-methoxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | ethyl (1R,6R,7S)-6-methoxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 70965616 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl (1R,6R,7S)-6-methoxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | CCOC(=O)C1C2O[C@@H]3COC(C)(C)O[C@H]3[C@H](OC)C21 |
| InChI | InChI=1S/C14H22O6/c1-5-17-13(15)9-8-11(9)19-7-6-18-14(2,3)20-10(7)12(8)16-4/h7-12H,5-6H2,1-4H3/t7-,8?,9?,10-,11?,12-/m1/s1 |
| InChIKey | FBZXPXGMXHZTFV-WQFWYRRQSA-N |
| XLogP | 0.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |