C12H18O6 — CID 70965617
methyl (1R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 70965617) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is methyl (1R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | methyl (1R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 70965617 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | methyl (1R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | COC(=O)C1C2O[C@@H]3COC(C)(C)O[C@H]3[C@H](O)C21 |
| InChI | InChI=1S/C12H18O6/c1-12(2)16-4-5-9(18-12)8(13)6-7(10(6)17-5)11(14)15-3/h5-10,13H,4H2,1-3H3/t5-,6?,7?,8-,9-,10?/m1/s1 |
| InChIKey | QYEFEDBWYRYWSA-PJLXRGQZSA-N |
| XLogP | -0.31 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |