C13H20O6 — CID 70965619
ethyl (1R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 70965619) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is ethyl (1R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | ethyl (1R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 70965619 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | ethyl (1R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | CCOC(=O)C1C2O[C@@H]3COC(C)(C)O[C@H]3[C@H](O)C21 |
| InChI | InChI=1S/C13H20O6/c1-4-16-12(15)8-7-9(14)10-6(18-11(7)8)5-17-13(2,3)19-10/h6-11,14H,4-5H2,1-3H3/t6-,7?,8?,9-,10-,11?/m1/s1 |
| InChIKey | BDAANRMKGCJFDT-WFEAUFEHSA-N |
| XLogP | 0.08 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |