About 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone
1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone (PubChem CID 70965961) has the molecular formula C9H11BrO
and a molecular weight of 215.09 g/mol. Its IUPAC name is 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone |
| PubChem CID | 70965961 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)C=CC(Br)=CC1 |
| InChI | InChI=1S/C9H11BrO/c1-7(11)9(2)5-3-8(10)4-6-9/h3-5H,6H2,1-2H3/t9-/m0/s1 |
| InChIKey | QUMGBXKCBFVWSO-VIFPVBQESA-N |
| XLogP | 2.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone?
The IUPAC name of 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone (CID 70965961) is 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone.
What is the SMILES notation for 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone?
The canonical SMILES for 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone is CC(=O)[C@@]1(C)C=CC(Br)=CC1.
What is the InChIKey of 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone?
The InChIKey is QUMGBXKCBFVWSO-VIFPVBQESA-N. The full InChI is InChI=1S/C9H11BrO/c1-7(11)9(2)5-3-8(10)4-6-9/h3-5H,6H2,1-2H3/t9-/m0/s1.
What are the key properties of 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone?
1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone has a molecular weight of 215.09 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-4-bromo-1-methylcyclohexa-2,4-dien-1-yl]ethanone is sourced from PubChem (CID 70965961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).