About 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one
3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one (PubChem CID 70966416) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one |
| PubChem CID | 70966416 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one |
| SMILES | Cc1cccc(C)c1CC1CCNC1=O |
| InChI | InChI=1S/C13H17NO/c1-9-4-3-5-10(2)12(9)8-11-6-7-14-13(11)15/h3-5,11H,6-8H2,1-2H3,(H,14,15) |
| InChIKey | JFPFIADYFJCQBY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one?
The IUPAC name of 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one (CID 70966416) is 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one.
What is the SMILES notation for 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one?
The canonical SMILES for 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one is Cc1cccc(C)c1CC1CCNC1=O.
What is the InChIKey of 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one?
The InChIKey is JFPFIADYFJCQBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-9-4-3-5-10(2)12(9)8-11-6-7-14-13(11)15/h3-5,11H,6-8H2,1-2H3,(H,14,15).
What are the key properties of 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one?
3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one has a molecular weight of 203.28 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 70966416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).