About (6S)-6-tert-butyl-2,2-diphenyloxasilinane
(6S)-6-tert-butyl-2,2-diphenyloxasilinane (PubChem CID 70967251) has the molecular formula C20H26OSi
and a molecular weight of 310.51 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2,2-diphenyloxasilinane.
Molecular Properties
| Compound Name | (6S)-6-tert-butyl-2,2-diphenyloxasilinane |
| PubChem CID | 70967251 |
| Molecular Formula | C20H26OSi |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (6S)-6-tert-butyl-2,2-diphenyloxasilinane |
| SMILES | CC(C)(C)[C@@H]1CCC[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C20H26OSi/c1-20(2,3)19-15-10-16-22(21-19,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,19H,10,15-16H2,1-3H3/t19-/m0/s1 |
| InChIKey | YOXUNFOKCDGVJC-IBGZPJMESA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6S)-6-tert-butyl-2,2-diphenyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-tert-butyl-2,2-diphenyloxasilinane?
The IUPAC name of (6S)-6-tert-butyl-2,2-diphenyloxasilinane (CID 70967251) is (6S)-6-tert-butyl-2,2-diphenyloxasilinane.
What is the SMILES notation for (6S)-6-tert-butyl-2,2-diphenyloxasilinane?
The canonical SMILES for (6S)-6-tert-butyl-2,2-diphenyloxasilinane is CC(C)(C)[C@@H]1CCC[Si](c2ccccc2)(c2ccccc2)O1.
What is the InChIKey of (6S)-6-tert-butyl-2,2-diphenyloxasilinane?
The InChIKey is YOXUNFOKCDGVJC-IBGZPJMESA-N. The full InChI is InChI=1S/C20H26OSi/c1-20(2,3)19-15-10-16-22(21-19,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,19H,10,15-16H2,1-3H3/t19-/m0/s1.
What are the key properties of (6S)-6-tert-butyl-2,2-diphenyloxasilinane?
(6S)-6-tert-butyl-2,2-diphenyloxasilinane has a molecular weight of 310.51 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-tert-butyl-2,2-diphenyloxasilinane is sourced from PubChem (CID 70967251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).