C37H29O5P — CID 70967761
15-[(1R,2R)-2-phenylcyclohexyl]oxy-8,14,16,22-tetraoxa-15-phosphaheptacyclo[15.11.1.11,9.02,7.021,29.023,28.013,30]triaconta-2,4,6,9(30),10,12,17,19,21(29),23,25,27-dodecaene (PubChem CID 70967761) has the molecular formula C37H29O5P and a molecular weight of 584.61 g/mol. Its IUPAC name is 15-[(1R,2R)-2-phenylcyclohexyl]oxy-8,14,16,22-tetraoxa-15-phosphaheptacyclo[15.11.1.11,9.02,7.021,29.023,28.013,30]triaconta-2,4,6,9(30),10,12,17,19,21(29),23,25,27-dodecaene.
| Compound Name | 15-[(1R,2R)-2-phenylcyclohexyl]oxy-8,14,16,22-tetraoxa-15-phosphaheptacyclo[15.11.1.11,9.02,7.021,29.023,28.013,30]triaconta-2,4,6,9(30),10,12,17,19,21(29),23,25,27-dodecaene |
|---|---|
| PubChem CID | 70967761 |
| Molecular Formula | C37H29O5P |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 15-[(1R,2R)-2-phenylcyclohexyl]oxy-8,14,16,22-tetraoxa-15-phosphaheptacyclo[15.11.1.11,9.02,7.021,29.023,28.013,30]triaconta-2,4,6,9(30),10,12,17,19,21(29),23,25,27-dodecaene |
| SMILES | c1ccc([C@H]2CCCC[C@H]2OP2Oc3cccc4c3C3(c5ccccc5O4)c4ccccc4Oc4cccc(c43)O2)cc1 |
| InChI | InChI=1S/C37H29O5P/c1-2-12-24(13-3-1)25-14-4-7-17-28(25)40-43-41-33-22-10-20-31-35(33)37(26-15-5-8-18-29(26)38-31)27-16-6-9-19-30(27)39-32-21-11-23-34(42-43)36(32)37/h1-3,5-6,8-13,15-16,18-23,25,28H,4,7,14,17H2/t25-,28-,37?/m1/s1 |
| InChIKey | QDKMOSWVMWVRAX-BOCBNTABSA-N |
| XLogP | 10.02 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|