C11H12N4S2 — CID 70967773
4-[3-(cyclopropylamino)phenyl]-1,2,4-triazolidine-3,5-dithione (PubChem CID 70967773) has the molecular formula C11H12N4S2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 4-[3-(cyclopropylamino)phenyl]-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-[3-(cyclopropylamino)phenyl]-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 70967773 |
| Molecular Formula | C11H12N4S2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4-[3-(cyclopropylamino)phenyl]-1,2,4-triazolidine-3,5-dithione |
| SMILES | S=c1[nH][nH]c(=S)n1-c1cccc(NC2CC2)c1 |
| InChI | InChI=1S/C11H12N4S2/c16-10-13-14-11(17)15(10)9-3-1-2-8(6-9)12-7-4-5-7/h1-3,6-7,12H,4-5H2,(H,13,16)(H,14,17) |
| InChIKey | DLWQUTIWMJDSRO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|