C18H34O6Si — CID 70967855
(1R,3S,7S,9S)-8-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol (PubChem CID 70967855) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is (1R,3S,7S,9S)-8-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol.
| Compound Name | (1R,3S,7S,9S)-8-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol |
|---|---|
| PubChem CID | 70967855 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (1R,3S,7S,9S)-8-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol |
| SMILES | CC1(C)O[C@@H]2C(O)[C@@H]3OC(C)(C)O[C@H]3C(CC(C)(C)[Si](C)(C)O)[C@@H]2O1 |
| InChI | InChI=1S/C18H34O6Si/c1-16(2,25(7,8)20)9-10-12-14(23-17(3,4)21-12)11(19)15-13(10)22-18(5,6)24-15/h10-15,19-20H,9H2,1-8H3/t10?,11?,12-,13-,14-,15+/m0/s1 |
| InChIKey | SWMHWVSIORQTKY-OIHRLHJKSA-N |
| XLogP | 2.38 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|