C27H35ClN2O7S — CID 70968173
1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]sulfanyl-3,3-dimethylbutan-2-one;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 70968173) has the molecular formula C27H35ClN2O7S and a molecular weight of 567.10 g/mol. Its IUPAC name is 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]sulfanyl-3,3-dimethylbutan-2-one;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]sulfanyl-3,3-dimethylbutan-2-one;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 70968173 |
| Molecular Formula | C27H35ClN2O7S |
| Molecular Weight | 567.10 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]sulfanyl-3,3-dimethylbutan-2-one;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | CC(C)(C)C(=O)CSc1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C23H29ClN2OS.C4H6O6/c1-23(2,3)21(27)15-28-18-7-4-16(5-8-18)14-26-22-19-11-13-25-12-10-17(19)6-9-20(22)24;5-1(3(7)8)2(6)4(9)10/h4-9,25-26H,10-15H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | VCSHJSLPTAOKKC-LREBCSMRSA-N |
| XLogP | 3.22 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |