C25H31ClF3N3O4 — CID 70968256
butanedioic acid;7-chloro-N-[[4-[(1,1,1-trifluoropropan-2-ylamino)methyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine (PubChem CID 70968256) has the molecular formula C25H31ClF3N3O4 and a molecular weight of 529.99 g/mol. Its IUPAC name is butanedioic acid;7-chloro-N-[[4-[(1,1,1-trifluoropropan-2-ylamino)methyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine.
| Compound Name | butanedioic acid;7-chloro-N-[[4-[(1,1,1-trifluoropropan-2-ylamino)methyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine |
|---|---|
| PubChem CID | 70968256 |
| Molecular Formula | C25H31ClF3N3O4 |
| Molecular Weight | 529.99 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | butanedioic acid;7-chloro-N-[[4-[(1,1,1-trifluoropropan-2-ylamino)methyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine |
| SMILES | CC(NCc1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1)C(F)(F)F.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C21H25ClF3N3.C4H6O4/c1-14(21(23,24)25)27-12-15-2-4-16(5-3-15)13-28-20-18-9-11-26-10-8-17(18)6-7-19(20)22;5-3(6)1-2-4(7)8/h2-7,14,26-28H,8-13H2,1H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | SSFFFSIROFFSFQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |