C32H43N5O9 — CID 70968460
(2S)-2-[[2-[[2-[(3S,6E,14S)-3-(2-methylpropoxycarbonylamino)-2,13-dioxo-1,12-diazabicyclo[12.3.0]heptadec-6-en-11-yl]-2-oxoacetyl]amino]acetyl]amino]-2-phenylacetic acid (PubChem CID 70968460) has the molecular formula C32H43N5O9 and a molecular weight of 641.72 g/mol. Its IUPAC name is (2S)-2-[[2-[[2-[(3S,6E,14S)-3-(2-methylpropoxycarbonylamino)-2,13-dioxo-1,12-diazabicyclo[12.3.0]heptadec-6-en-11-yl]-2-oxoacetyl]amino]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[2-[[2-[(3S,6E,14S)-3-(2-methylpropoxycarbonylamino)-2,13-dioxo-1,12-diazabicyclo[12.3.0]heptadec-6-en-11-yl]-2-oxoacetyl]amino]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 70968460 |
| Molecular Formula | C32H43N5O9 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | (2S)-2-[[2-[[2-[(3S,6E,14S)-3-(2-methylpropoxycarbonylamino)-2,13-dioxo-1,12-diazabicyclo[12.3.0]heptadec-6-en-11-yl]-2-oxoacetyl]amino]acetyl]amino]-2-phenylacetic acid |
| SMILES | CC(C)COC(=O)N[C@H]1CC/C=C/CCCC(C(=O)C(=O)NCC(=O)N[C@H](C(=O)O)c2ccccc2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C32H43N5O9/c1-20(2)19-46-32(45)35-23-15-10-5-3-4-9-14-22(34-28(40)24-16-11-17-37(24)30(23)42)27(39)29(41)33-18-25(38)36-26(31(43)44)21-12-7-6-8-13-21/h3,5-8,12-13,20,22-24,26H,4,9-11,14-19H2,1-2H3,(H,33,41)(H,34,40)(H,35,45)(H,36,38)(H,43,44)/b5-3+/t22?,23-,24-,26-/m0/s1 |
| InChIKey | GJWLIRMWTJBOAU-LLPSUWLFSA-N |
| XLogP | 1.36 |
| TPSA | 200.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|