C29H33NO3 — CID 70968699
benzyl N-benzyl-N-[(E)-7-methoxy-5-phenylhept-6-en-2-yl]carbamate (PubChem CID 70968699) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is benzyl N-benzyl-N-[(E)-7-methoxy-5-phenylhept-6-en-2-yl]carbamate.
| Compound Name | benzyl N-benzyl-N-[(E)-7-methoxy-5-phenylhept-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 70968699 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | benzyl N-benzyl-N-[(E)-7-methoxy-5-phenylhept-6-en-2-yl]carbamate |
| SMILES | CO/C=C/C(CCC(C)N(Cc1ccccc1)C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO3/c1-24(18-19-28(20-21-32-2)27-16-10-5-11-17-27)30(22-25-12-6-3-7-13-25)29(31)33-23-26-14-8-4-9-15-26/h3-17,20-21,24,28H,18-19,22-23H2,1-2H3/b21-20+ |
| InChIKey | BDQMIAFESWQFPI-QZQOTICOSA-N |
| XLogP | 6.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|