C21H34N2O4 — CID 70968787
4-tert-butyl-N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclohexane-1-carboxamide (PubChem CID 70968787) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 70968787 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 4-tert-butyl-N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)C1CCC(C(=O)NC2COC3C(NC(=O)C4CC4)COC23)CC1 |
| InChI | InChI=1S/C21H34N2O4/c1-21(2,3)14-8-6-13(7-9-14)20(25)23-16-11-27-17-15(10-26-18(16)17)22-19(24)12-4-5-12/h12-18H,4-11H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | LQVJWEBWEGYRMB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |