C23H27FN4O4S — CID 70969200
2-[[(2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]ethanesulfinic acid (PubChem CID 70969200) has the molecular formula C23H27FN4O4S and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[[(2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]ethanesulfinic acid.
| Compound Name | 2-[[(2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]ethanesulfinic acid |
|---|---|
| PubChem CID | 70969200 |
| Molecular Formula | C23H27FN4O4S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[[(2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]ethanesulfinic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)c1nn(Cc2ccc(F)cc2)c2ccccc12)C(=O)NCCS(=O)O |
| InChI | InChI=1S/C23H27FN4O4S/c1-23(2,3)20(22(30)25-12-13-33(31)32)26-21(29)19-17-6-4-5-7-18(17)28(27-19)14-15-8-10-16(24)11-9-15/h4-11,20H,12-14H2,1-3H3,(H,25,30)(H,26,29)(H,31,32)/t20-/m1/s1 |
| InChIKey | NQDKLZFLCMKEAK-HXUWFJFHSA-N |
| XLogP | 2.71 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|