C22H30N6O4 — CID 70969748
ethyl 5-[1-[[1-(4-aminobutyl)indazole-3-carbonyl]amino]-2,2-dimethylpropyl]-1,2,4-oxadiazole-3-carboxylate (PubChem CID 70969748) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is ethyl 5-[1-[[1-(4-aminobutyl)indazole-3-carbonyl]amino]-2,2-dimethylpropyl]-1,2,4-oxadiazole-3-carboxylate.
| Compound Name | ethyl 5-[1-[[1-(4-aminobutyl)indazole-3-carbonyl]amino]-2,2-dimethylpropyl]-1,2,4-oxadiazole-3-carboxylate |
|---|---|
| PubChem CID | 70969748 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | ethyl 5-[1-[[1-(4-aminobutyl)indazole-3-carbonyl]amino]-2,2-dimethylpropyl]-1,2,4-oxadiazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(C(NC(=O)c2nn(CCCCN)c3ccccc23)C(C)(C)C)n1 |
| InChI | InChI=1S/C22H30N6O4/c1-5-31-21(30)18-25-20(32-27-18)17(22(2,3)4)24-19(29)16-14-10-6-7-11-15(14)28(26-16)13-9-8-12-23/h6-7,10-11,17H,5,8-9,12-13,23H2,1-4H3,(H,24,29) |
| InChIKey | WWPCGWOTOCJYOO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|