About ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate
ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate (PubChem CID 70970111) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate |
| PubChem CID | 70970111 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate |
| SMILES | CCCC1(N)CC(C)Cn2c1nc(C(=O)OCC)c(O)c2=O |
| InChI | InChI=1S/C15H23N3O4/c1-4-6-15(16)7-9(3)8-18-12(20)11(19)10(17-14(15)18)13(21)22-5-2/h9,19H,4-8,16H2,1-3H3 |
| InChIKey | KZIOVGSHVPKCBP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate?
The IUPAC name of ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate (CID 70970111) is ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate.
What is the SMILES notation for ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate?
The canonical SMILES for ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate is CCCC1(N)CC(C)Cn2c1nc(C(=O)OCC)c(O)c2=O.
What is the InChIKey of ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate?
The InChIKey is KZIOVGSHVPKCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O4/c1-4-6-15(16)7-9(3)8-18-12(20)11(19)10(17-14(15)18)13(21)22-5-2/h9,19H,4-8,16H2,1-3H3.
What are the key properties of ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate?
ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate has a molecular weight of 309.37 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-amino-3-hydroxy-7-methyl-4-oxo-9-propyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylate is sourced from PubChem (CID 70970111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).