C15H24N4O3S — CID 70970229
7-[[[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylsulfanylethyl]amino]methyl]-1,2,3,5-tetrahydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 70970229) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 7-[[[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylsulfanylethyl]amino]methyl]-1,2,3,5-tetrahydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[[[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylsulfanylethyl]amino]methyl]-1,2,3,5-tetrahydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 70970229 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 7-[[[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylsulfanylethyl]amino]methyl]-1,2,3,5-tetrahydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CSC[C@H](NCc1c[nH]c2c1NCNC2=O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H24N4O3S/c1-15(2)21-6-11(22-15)10(7-23-3)16-4-9-5-17-13-12(9)18-8-19-14(13)20/h5,10-11,16-18H,4,6-8H2,1-3H3,(H,19,20)/t10-,11-/m0/s1 |
| InChIKey | KWWZPZDZNJCQGM-QWRGUYRKSA-N |
| XLogP | 1.10 |
| TPSA | 87.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |