C14H16Cl2N4 — CID 70970247
4-(3,4-dichlorophenyl)-4-(1,2,4-triazol-1-ylmethyl)piperidine (PubChem CID 70970247) has the molecular formula C14H16Cl2N4 and a molecular weight of 311.22 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-4-(1,2,4-triazol-1-ylmethyl)piperidine.
| Compound Name | 4-(3,4-dichlorophenyl)-4-(1,2,4-triazol-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 70970247 |
| Molecular Formula | C14H16Cl2N4 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-4-(1,2,4-triazol-1-ylmethyl)piperidine |
| SMILES | Clc1ccc(C2(Cn3cncn3)CCNCC2)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N4/c15-12-2-1-11(7-13(12)16)14(3-5-17-6-4-14)8-20-10-18-9-19-20/h1-2,7,9-10,17H,3-6,8H2 |
| InChIKey | AXCANNIFVIWXRS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |