About CID 70970987
CID 70970987 (PubChem CID 70970987) has the molecular formula C17H19N2O2SSi
and a molecular weight of 343.50 g/mol.
Molecular Properties
| Compound Name | CID 70970987 |
| PubChem CID | 70970987 |
| Molecular Formula | C17H19N2O2SSi |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1cc2ccc([Si](C)C)cc2n1Cc1nccs1 |
| InChI | InChI=1S/C17H19N2O2SSi/c1-4-21-17(20)15-9-12-5-6-13(23(2)3)10-14(12)19(15)11-16-18-7-8-22-16/h5-10H,4,11H2,1-3H3 |
| InChIKey | ASZBONVOWLWHOJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 70970987 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70970987?
The IUPAC name of CID 70970987 (CID 70970987) is not available.
What is the SMILES notation for CID 70970987?
The canonical SMILES for CID 70970987 is CCOC(=O)c1cc2ccc([Si](C)C)cc2n1Cc1nccs1.
What is the InChIKey of CID 70970987?
The InChIKey is ASZBONVOWLWHOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N2O2SSi/c1-4-21-17(20)15-9-12-5-6-13(23(2)3)10-14(12)19(15)11-16-18-7-8-22-16/h5-10H,4,11H2,1-3H3.
What are the key properties of CID 70970987?
CID 70970987 has a molecular weight of 343.50 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70970987 is sourced from PubChem (CID 70970987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).