About 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one
6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one (PubChem CID 709713) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one |
| PubChem CID | 709713 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one |
| SMILES | CC1(C)CC(=O)c2c(noc2-c2ccccc2)C1 |
| InChI | InChI=1S/C15H15NO2/c1-15(2)8-11-13(12(17)9-15)14(18-16-11)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | KYTFDPUNAIZGBJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one?
The IUPAC name of 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one (CID 709713) is 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one.
What is the SMILES notation for 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one?
The canonical SMILES for 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one is CC1(C)CC(=O)c2c(noc2-c2ccccc2)C1.
What is the InChIKey of 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one?
The InChIKey is KYTFDPUNAIZGBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-15(2)8-11-13(12(17)9-15)14(18-16-11)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3.
What are the key properties of 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one?
6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one has a molecular weight of 241.29 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-3-phenyl-5,7-dihydro-2,1-benzoxazol-4-one is sourced from PubChem (CID 709713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).