C20H22ClN3O3 — CID 70971765
3-[5-(4-chlorocyclohexa-2,4-dien-1-yl)oxypentylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 70971765) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 3-[5-(4-chlorocyclohexa-2,4-dien-1-yl)oxypentylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[5-(4-chlorocyclohexa-2,4-dien-1-yl)oxypentylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 70971765 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[5-(4-chlorocyclohexa-2,4-dien-1-yl)oxypentylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCCCCOC2C=CC(Cl)=CC2)c(Nc2ccncc2)c1=O |
| InChI | InChI=1S/C20H22ClN3O3/c21-14-4-6-16(7-5-14)27-13-3-1-2-10-23-17-18(20(26)19(17)25)24-15-8-11-22-12-9-15/h4-6,8-9,11-12,16,23H,1-3,7,10,13H2,(H,22,24) |
| InChIKey | WIAVOCOCFFEXCC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|