C16H21N — CID 70971955
4-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-N,N-dimethylaniline (PubChem CID 70971955) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-N,N-dimethylaniline.
| Compound Name | 4-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 70971955 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 4-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-N,N-dimethylaniline |
| SMILES | CC1=C(C)CCC(c2ccc(N(C)C)cc2)=C1 |
| InChI | InChI=1S/C16H21N/c1-12-5-6-15(11-13(12)2)14-7-9-16(10-8-14)17(3)4/h7-11H,5-6H2,1-4H3 |
| InChIKey | PFJUFBLAFXKXAC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|