C41H44N2 — CID 70971997
9-[4-(2-cyclohexa-1,5-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethyl)cyclohexa-1,5-dien-1-yl]-6-(5-methyl-2,3-dihydroindol-1-yl)-3,4,4b,5-tetrahydrocarbazole (PubChem CID 70971997) has the molecular formula C41H44N2 and a molecular weight of 564.82 g/mol. Its IUPAC name is 9-[4-(2-cyclohexa-1,5-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethyl)cyclohexa-1,5-dien-1-yl]-6-(5-methyl-2,3-dihydroindol-1-yl)-3,4,4b,5-tetrahydrocarbazole.
| Compound Name | 9-[4-(2-cyclohexa-1,5-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethyl)cyclohexa-1,5-dien-1-yl]-6-(5-methyl-2,3-dihydroindol-1-yl)-3,4,4b,5-tetrahydrocarbazole |
|---|---|
| PubChem CID | 70971997 |
| Molecular Formula | C41H44N2 |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | 9-[4-(2-cyclohexa-1,5-dien-1-yl-2-cyclohexa-2,4-dien-1-ylethyl)cyclohexa-1,5-dien-1-yl]-6-(5-methyl-2,3-dihydroindol-1-yl)-3,4,4b,5-tetrahydrocarbazole |
| SMILES | Cc1ccc2c(c1)CCN2C1=CC=C2C(C1)C1=C(C=CCC1)N2C1=CCC(CC(C2=CCCC=C2)C2C=CC=CC2)C=C1 |
| InChI | InChI=1S/C41H44N2/c1-29-16-22-39-33(26-29)24-25-42(39)35-21-23-41-38(28-35)36-14-8-9-15-40(36)43(41)34-19-17-30(18-20-34)27-37(31-10-4-2-5-11-31)32-12-6-3-7-13-32/h2,4-6,9-10,12-13,15-17,19-23,26,30-31,37-38H,3,7-8,11,14,18,24-25,27-28H2,1H3 |
| InChIKey | HUIGAPFMYQWPAO-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |