About 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid
3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 70972496) has the molecular formula C10H11F2N3O5
and a molecular weight of 291.21 g/mol. Its IUPAC name is 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| PubChem CID | 70972496 |
| Molecular Formula | C10H11F2N3O5 |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | [N-]=[N+]=NC(OC(=O)C1C2CCC(O2)C1C(=O)O)C(F)F |
| InChI | InChI=1S/C10H11F2N3O5/c11-7(12)8(14-15-13)20-10(18)6-4-2-1-3(19-4)5(6)9(16)17/h3-8H,1-2H2,(H,16,17) |
| InChIKey | KCARAOSTTSMKJZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid?
The IUPAC name of 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CID 70972496) is 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
What is the SMILES notation for 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid?
The canonical SMILES for 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid is [N-]=[N+]=NC(OC(=O)C1C2CCC(O2)C1C(=O)O)C(F)F.
What is the InChIKey of 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid?
The InChIKey is KCARAOSTTSMKJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N3O5/c11-7(12)8(14-15-13)20-10(18)6-4-2-1-3(19-4)5(6)9(16)17/h3-8H,1-2H2,(H,16,17).
What are the key properties of 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid?
3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid has a molecular weight of 291.21 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-azido-2,2-difluoroethoxy)carbonyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid is sourced from PubChem (CID 70972496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).