C16H26O2 — CID 70972585
1,8-di(cyclobutyl)octane-1,8-dione (PubChem CID 70972585) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1,8-di(cyclobutyl)octane-1,8-dione.
| Compound Name | 1,8-di(cyclobutyl)octane-1,8-dione |
|---|---|
| PubChem CID | 70972585 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1,8-di(cyclobutyl)octane-1,8-dione |
| SMILES | O=C(CCCCCCC(=O)C1CCC1)C1CCC1 |
| InChI | InChI=1S/C16H26O2/c17-15(13-7-5-8-13)11-3-1-2-4-12-16(18)14-9-6-10-14/h13-14H,1-12H2 |
| InChIKey | HZIDHEMUCRBYKQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|