C16H12N2O4 — CID 709733
5-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 709733) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 709733 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(-c3ccc4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C16H12N2O4/c1-19-12-5-2-10(3-6-12)15-17-16(22-18-15)11-4-7-13-14(8-11)21-9-20-13/h2-8H,9H2,1H3 |
| InChIKey | SZNQRLOVTBRQIM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |