C24H24FN3O2S — CID 70973360
amino 3-[2-fluoro-4-[(4-phenyl-2,3-dihydro-1,4-benzothiazin-6-yl)methylamino]phenyl]propanoate (PubChem CID 70973360) has the molecular formula C24H24FN3O2S and a molecular weight of 437.54 g/mol. Its IUPAC name is amino 3-[2-fluoro-4-[(4-phenyl-2,3-dihydro-1,4-benzothiazin-6-yl)methylamino]phenyl]propanoate.
| Compound Name | amino 3-[2-fluoro-4-[(4-phenyl-2,3-dihydro-1,4-benzothiazin-6-yl)methylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 70973360 |
| Molecular Formula | C24H24FN3O2S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | amino 3-[2-fluoro-4-[(4-phenyl-2,3-dihydro-1,4-benzothiazin-6-yl)methylamino]phenyl]propanoate |
| SMILES | NOC(=O)CCc1ccc(NCc2ccc3c(c2)N(c2ccccc2)CCS3)cc1F |
| InChI | InChI=1S/C24H24FN3O2S/c25-21-15-19(9-7-18(21)8-11-24(29)30-26)27-16-17-6-10-23-22(14-17)28(12-13-31-23)20-4-2-1-3-5-20/h1-7,9-10,14-15,27H,8,11-13,16,26H2 |
| InChIKey | JZGWTOYOLVETFS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|