About phenazine-1-carboxylate
phenazine-1-carboxylate (PubChem CID 7097402) has the molecular formula C13H7N2O2-
and a molecular weight of 223.21 g/mol. Its IUPAC name is phenazine-1-carboxylate.
Molecular Properties
| Compound Name | phenazine-1-carboxylate |
| PubChem CID | 7097402 |
| Molecular Formula | C13H7N2O2- |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | phenazine-1-carboxylate |
| SMILES | O=C([O-])c1cccc2nc3ccccc3nc12 |
| InChI | InChI=1S/C13H8N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H,(H,16,17)/p-1 |
| InChIKey | JGCSKOVQDXEQHI-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine-1-carboxylate?
The IUPAC name of phenazine-1-carboxylate (CID 7097402) is phenazine-1-carboxylate.
What is the SMILES notation for phenazine-1-carboxylate?
The canonical SMILES for phenazine-1-carboxylate is O=C([O-])c1cccc2nc3ccccc3nc12.
What is the InChIKey of phenazine-1-carboxylate?
The InChIKey is JGCSKOVQDXEQHI-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H8N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H,(H,16,17)/p-1.
What are the key properties of phenazine-1-carboxylate?
phenazine-1-carboxylate has a molecular weight of 223.21 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine-1-carboxylate is sourced from PubChem (CID 7097402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).