About 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol
2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol (PubChem CID 70974039) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol |
| PubChem CID | 70974039 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol |
| SMILES | OCCOC1=CCCC(OCCO)=C1 |
| InChI | InChI=1S/C10H16O4/c11-4-6-13-9-2-1-3-10(8-9)14-7-5-12/h2,8,11-12H,1,3-7H2 |
| InChIKey | KERCQWABUGVASR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol?
The IUPAC name of 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol (CID 70974039) is 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol.
What is the SMILES notation for 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol?
The canonical SMILES for 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol is OCCOC1=CCCC(OCCO)=C1.
What is the InChIKey of 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol?
The InChIKey is KERCQWABUGVASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c11-4-6-13-9-2-1-3-10(8-9)14-7-5-12/h2,8,11-12H,1,3-7H2.
What are the key properties of 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol?
2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol has a molecular weight of 200.23 g/mol, XLogP of 0.57, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-hydroxyethoxy)cyclohexa-1,3-dien-1-yl]oxyethanol is sourced from PubChem (CID 70974039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).