About (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol
(S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol (PubChem CID 70974362) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol.
Molecular Properties
| Compound Name | (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol |
| PubChem CID | 70974362 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol |
| SMILES | NC1=CCC(N[C@@H](O)C2CCCCC2)C=C1 |
| InChI | InChI=1S/C13H22N2O/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10/h6-8,10,12-13,15-16H,1-5,9,14H2/t12?,13-/m0/s1 |
| InChIKey | ZBCRQFVVIGJODK-ABLWVSNPSA-N |
| XLogP | 1.65 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol?
The IUPAC name of (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol (CID 70974362) is (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol.
What is the SMILES notation for (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol?
The canonical SMILES for (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol is NC1=CCC(N[C@@H](O)C2CCCCC2)C=C1.
What is the InChIKey of (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol?
The InChIKey is ZBCRQFVVIGJODK-ABLWVSNPSA-N. The full InChI is InChI=1S/C13H22N2O/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10/h6-8,10,12-13,15-16H,1-5,9,14H2/t12?,13-/m0/s1.
What are the key properties of (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol?
(S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol has a molecular weight of 222.33 g/mol, XLogP of 1.65, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-[(4-aminocyclohexa-2,4-dien-1-yl)amino]-cyclohexylmethanol is sourced from PubChem (CID 70974362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).