About 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine
4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine (PubChem CID 70974382) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine |
| PubChem CID | 70974382 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine |
| SMILES | CC1CN(C2=CCC(N)C=C2)C[C@@H](C)O1 |
| InChI | InChI=1S/C12H20N2O/c1-9-7-14(8-10(2)15-9)12-5-3-11(13)4-6-12/h3,5-6,9-11H,4,7-8,13H2,1-2H3/t9-,10?,11?/m1/s1 |
| InChIKey | FPUYGJQJGJPVQU-KPPDAEKUSA-N |
| XLogP | 1.27 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine?
The IUPAC name of 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine (CID 70974382) is 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine is CC1CN(C2=CCC(N)C=C2)C[C@@H](C)O1.
What is the InChIKey of 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine?
The InChIKey is FPUYGJQJGJPVQU-KPPDAEKUSA-N. The full InChI is InChI=1S/C12H20N2O/c1-9-7-14(8-10(2)15-9)12-5-3-11(13)4-6-12/h3,5-6,9-11H,4,7-8,13H2,1-2H3/t9-,10?,11?/m1/s1.
What are the key properties of 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine?
4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine has a molecular weight of 208.30 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2,6-dimethylmorpholin-4-yl]cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 70974382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).