C19H31N3O3 — CID 70974395
N-[4-(2,6-dimethylmorpholine-4-carbonyl)cyclohexa-2,4-dien-1-yl]-5-(methylamino)pentanamide (PubChem CID 70974395) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholine-4-carbonyl)cyclohexa-2,4-dien-1-yl]-5-(methylamino)pentanamide.
| Compound Name | N-[4-(2,6-dimethylmorpholine-4-carbonyl)cyclohexa-2,4-dien-1-yl]-5-(methylamino)pentanamide |
|---|---|
| PubChem CID | 70974395 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholine-4-carbonyl)cyclohexa-2,4-dien-1-yl]-5-(methylamino)pentanamide |
| SMILES | CNCCCCC(=O)NC1C=CC(C(=O)N2CC(C)OC(C)C2)=CC1 |
| InChI | InChI=1S/C19H31N3O3/c1-14-12-22(13-15(2)25-14)19(24)16-7-9-17(10-8-16)21-18(23)6-4-5-11-20-3/h7-9,14-15,17,20H,4-6,10-13H2,1-3H3,(H,21,23) |
| InChIKey | LJPBZGIRNZBAFV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|