About 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine
4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine (PubChem CID 70974415) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine |
| PubChem CID | 70974415 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine |
| SMILES | CC1C[C@@H](C)CN(C2C=CC(N)CC2)C1 |
| InChI | InChI=1S/C13H24N2/c1-10-7-11(2)9-15(8-10)13-5-3-12(14)4-6-13/h3,5,10-13H,4,6-9,14H2,1-2H3/t10-,11?,12?,13?/m1/s1 |
| InChIKey | DGARBQOGGHDQCX-PEWWYSNMSA-N |
| XLogP | 2.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine?
The IUPAC name of 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine (CID 70974415) is 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine.
What is the SMILES notation for 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine?
The canonical SMILES for 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine is CC1C[C@@H](C)CN(C2C=CC(N)CC2)C1.
What is the InChIKey of 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine?
The InChIKey is DGARBQOGGHDQCX-PEWWYSNMSA-N. The full InChI is InChI=1S/C13H24N2/c1-10-7-11(2)9-15(8-10)13-5-3-12(14)4-6-13/h3,5,10-13H,4,6-9,14H2,1-2H3/t10-,11?,12?,13?/m1/s1.
What are the key properties of 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine?
4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine has a molecular weight of 208.35 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5R)-3,5-dimethylpiperidin-1-yl]cyclohex-2-en-1-amine is sourced from PubChem (CID 70974415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).