About 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide
4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide (PubChem CID 70974417) has the molecular formula C14H21F3N2O
and a molecular weight of 290.33 g/mol. Its IUPAC name is 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide |
| PubChem CID | 70974417 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CC[C@@H](/C=C\CNC(=O)C1CC=C(N)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O/c1-2-11(14(15,16)17)4-3-9-19-13(20)10-5-7-12(18)8-6-10/h3-4,7,10-11H,2,5-6,8-9,18H2,1H3,(H,19,20)/b4-3-/t10?,11-/m0/s1 |
| InChIKey | IRZXKTUXOLYCOW-UEKJJVEBSA-N |
| XLogP | 2.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide?
The IUPAC name of 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide (CID 70974417) is 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide.
What is the SMILES notation for 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide?
The canonical SMILES for 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide is CC[C@@H](/C=C\CNC(=O)C1CC=C(N)CC1)C(F)(F)F.
What is the InChIKey of 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide?
The InChIKey is IRZXKTUXOLYCOW-UEKJJVEBSA-N. The full InChI is InChI=1S/C14H21F3N2O/c1-2-11(14(15,16)17)4-3-9-19-13(20)10-5-7-12(18)8-6-10/h3-4,7,10-11H,2,5-6,8-9,18H2,1H3,(H,19,20)/b4-3-/t10?,11-/m0/s1.
What are the key properties of 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide?
4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide has a molecular weight of 290.33 g/mol, XLogP of 2.89, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[(Z,4S)-4-(trifluoromethyl)hex-2-enyl]cyclohex-3-ene-1-carboxamide is sourced from PubChem (CID 70974417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).